Boronic acid, B-[4-(difluoromethoxy)phenyl]-

Boronic acid, B-[4-(difluoromethoxy)phenyl]- - Names and Identifiers

Name	[4-(difluoromethoxy)phenyl]boronic acid
Synonyms	Boronic acid, B-[4-(difluorom 4-Difluoromethoxyphenylboronic acid 4-Borono-alpha,alpha-difluoroanisole 4-difluoromethoxy-phenylboronic acid (4-(Difluoromethoxy)phenyl)boronicaci 4-(Difluoromethoxy)-phenylboronic acid [4-(difluoromethoxy)phenyl]boronic acid B-[4-(Difluoromethoxy)phenyl]boronic acid Boronic acid, B-[4-(difluoromethoxy)phenyl]- boronic acid, B-[4-(difluoromethoxy)phenyl]- Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI)
CAS	688810-12-0
InChI	InChI=1/C7H7BF2O3/c9-7(10)13-6-3-1-5(2-4-6)8(11)12/h1-4,7,11-12H

Boronic acid, B-[4-(difluoromethoxy)phenyl]- - Physico-chemical Properties

Molecular Formula	C7H7BF2O3
Molar Mass	187.94
Density	1.33±0.1 g/cm3(Predicted)
Boling Point	299.8±50.0 °C(Predicted)
Flash Point	135.1°C
Vapor Presure	0.000521mmHg at 25°C
pKa	8.41±0.16(Predicted)
Storage Condition	Inert atmosphere,Store in freezer, under -20°C
Refractive Index	1.478

Boronic acid, B-[4-(difluoromethoxy)phenyl]- - Introduction

[4-(difluoromethoxy)phenyl]boronic acid is an organic boron compound with the chemical formula C7H6BF2O3. It has the following properties:

1. Appearance:[4-(difluoromethoxy)phenyl]boronic acid is a white to light yellow solid powder.

2. Solubility: It is soluble in some organic solvents at room temperature, such as ethanol and dimethylformamide.

3. Stability:[4-(difluoromethoxy)phenyl]boronic acid is relatively stable under dry conditions, but it will hydrolyze rapidly in a humid environment.

[4-(difluoromethoxy)phenyl]boronic acid has several applications:

1. Organic synthesis: It can be used as an important organic synthesis intermediate for the synthesis of drugs, pesticides, functional materials, etc.

2. Chemical catalyst:[4-(difluoromethoxy)phenyl]boronic acid can be used as a ligand of platinum catalyst for organic synthesis reactions. The more common catalyst is its palladium complex.

The method for preparing [4-(difluoromethoxy)phenyl]boronic acid is generally obtained by reacting boric acid with p-difluoromethylphenol.

Last Update：2024-04-09 18:58:34